About 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine
2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 45167401) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine |
| PubChem CID | 45167401 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | COc1ccccc1C1CN(Cc2cnn(C)c2)Cc2ccccc2O1 |
| InChI | InChI=1S/C21H23N3O2/c1-23-12-16(11-22-23)13-24-14-17-7-3-5-9-19(17)26-21(15-24)18-8-4-6-10-20(18)25-2/h3-12,21H,13-15H2,1-2H3 |
| InChIKey | SNJSAQBTDULAFM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine?
The IUPAC name of 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine (CID 45167401) is 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine.
What is the SMILES notation for 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine?
The canonical SMILES for 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine is COc1ccccc1C1CN(Cc2cnn(C)c2)Cc2ccccc2O1.
What is the InChIKey of 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine?
The InChIKey is SNJSAQBTDULAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-23-12-16(11-22-23)13-24-14-17-7-3-5-9-19(17)26-21(15-24)18-8-4-6-10-20(18)25-2/h3-12,21H,13-15H2,1-2H3.
What are the key properties of 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine?
2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine has a molecular weight of 349.43 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-4-[(1-methylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine is sourced from PubChem (CID 45167401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).