C23H27NO3S — CID 45167786
3-(4-methoxyphenyl)-1-[3-(2-methylsulfanylbenzoyl)piperidin-1-yl]propan-1-one (PubChem CID 45167786) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[3-(2-methylsulfanylbenzoyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(4-methoxyphenyl)-1-[3-(2-methylsulfanylbenzoyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 45167786 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[3-(2-methylsulfanylbenzoyl)piperidin-1-yl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCCC(C(=O)c3ccccc3SC)C2)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-27-19-12-9-17(10-13-19)11-14-22(25)24-15-5-6-18(16-24)23(26)20-7-3-4-8-21(20)28-2/h3-4,7-10,12-13,18H,5-6,11,14-16H2,1-2H3 |
| InChIKey | DRJJLVUANPMNEU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |