About (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide
(E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 45168383) has the molecular formula C20H19FN2O2
and a molecular weight of 338.38 g/mol. Its IUPAC name is (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide |
| PubChem CID | 45168383 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC1CC(Cc2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C20H19FN2O2/c21-17-9-6-16(7-10-17)12-18-13-19(25-23-18)14-22-20(24)11-8-15-4-2-1-3-5-15/h1-11,19H,12-14H2,(H,22,24)/b11-8+ |
| InChIKey | LISKAGKRFFJVBG-DHZHZOJOSA-N |
| XLogP | 3.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide?
The IUPAC name of (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide (CID 45168383) is (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide.
What is the SMILES notation for (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide?
The canonical SMILES for (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide is O=C(/C=C/c1ccccc1)NCC1CC(Cc2ccc(F)cc2)=NO1.
What is the InChIKey of (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide?
The InChIKey is LISKAGKRFFJVBG-DHZHZOJOSA-N. The full InChI is InChI=1S/C20H19FN2O2/c21-17-9-6-16(7-10-17)12-18-13-19(25-23-18)14-22-20(24)11-8-15-4-2-1-3-5-15/h1-11,19H,12-14H2,(H,22,24)/b11-8+.
What are the key properties of (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide?
(E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide has a molecular weight of 338.38 g/mol, XLogP of 3.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[[3-[(4-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylprop-2-enamide is sourced from PubChem (CID 45168383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).