C29H25ClN4 — CID 4516872
2-(2-chloroethyl)-1-(dibenzylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 4516872) has the molecular formula C29H25ClN4 and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(dibenzylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 2-(2-chloroethyl)-1-(dibenzylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 4516872 |
| Molecular Formula | C29H25ClN4 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-(2-chloroethyl)-1-(dibenzylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1c(CCCl)c(N(Cc2ccccc2)Cc2ccccc2)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C29H25ClN4/c1-21-24(16-17-30)29(34-27-15-9-8-14-26(27)32-28(34)25(21)18-31)33(19-22-10-4-2-5-11-22)20-23-12-6-3-7-13-23/h2-15H,16-17,19-20H2,1H3 |
| InChIKey | HZHDSYFBJDJGRQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|