About methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate
methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate (PubChem CID 45169386) has the molecular formula C15H17FN2O4
and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate |
| PubChem CID | 45169386 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)C1CC(Cc2cccc(F)c2)=NO1 |
| InChI | InChI=1S/C15H17FN2O4/c1-18(9-14(19)21-2)15(20)13-8-12(17-22-13)7-10-4-3-5-11(16)6-10/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | YRXXKCLRDUCBIR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate?
The IUPAC name of methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate (CID 45169386) is methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate.
What is the SMILES notation for methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate?
The canonical SMILES for methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate is COC(=O)CN(C)C(=O)C1CC(Cc2cccc(F)c2)=NO1.
What is the InChIKey of methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate?
The InChIKey is YRXXKCLRDUCBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O4/c1-18(9-14(19)21-2)15(20)13-8-12(17-22-13)7-10-4-3-5-11(16)6-10/h3-6,13H,7-9H2,1-2H3.
What are the key properties of methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate?
methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate has a molecular weight of 308.31 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[3-[(3-fluorophenyl)methyl]-4,5-dihydro-1,2-oxazole-5-carbonyl]-methylamino]acetate is sourced from PubChem (CID 45169386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).