C19H23N3O5S — CID 45169454
2-(furan-2-carbonylamino)-7-oxo-N-(3-propan-2-yloxypropyl)-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide (PubChem CID 45169454) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(furan-2-carbonylamino)-7-oxo-N-(3-propan-2-yloxypropyl)-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-(furan-2-carbonylamino)-7-oxo-N-(3-propan-2-yloxypropyl)-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 45169454 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-(furan-2-carbonylamino)-7-oxo-N-(3-propan-2-yloxypropyl)-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CC(=O)c2sc(NC(=O)c3ccco3)nc2C1 |
| InChI | InChI=1S/C19H23N3O5S/c1-11(2)26-8-4-6-20-17(24)12-9-13-16(14(23)10-12)28-19(21-13)22-18(25)15-5-3-7-27-15/h3,5,7,11-12H,4,6,8-10H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | BYNIAJWGBGZJPL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|