C25H27F3N2O2 — CID 45169875
(E)-3-(3,4-difluorophenyl)-N-[[8-[(2-fluorophenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide (PubChem CID 45169875) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-N-[[8-[(2-fluorophenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorophenyl)-N-[[8-[(2-fluorophenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 45169875 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-N-[[8-[(2-fluorophenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)c(F)c1)NCC1CCC2(CCN(Cc3ccccc3F)CC2)O1 |
| InChI | InChI=1S/C25H27F3N2O2/c26-21-4-2-1-3-19(21)17-30-13-11-25(12-14-30)10-9-20(32-25)16-29-24(31)8-6-18-5-7-22(27)23(28)15-18/h1-8,15,20H,9-14,16-17H2,(H,29,31)/b8-6+ |
| InChIKey | MEDMKTJUIWJRKK-SOFGYWHQSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|