C19H24FN3O2 — CID 45169937
[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-3-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 45169937) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is [1-[(1-ethylpyrazol-4-yl)methyl]piperidin-3-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [1-[(1-ethylpyrazol-4-yl)methyl]piperidin-3-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 45169937 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [1-[(1-ethylpyrazol-4-yl)methyl]piperidin-3-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | CCn1cc(CN2CCCC(C(=O)c3ccc(OC)c(F)c3)C2)cn1 |
| InChI | InChI=1S/C19H24FN3O2/c1-3-23-12-14(10-21-23)11-22-8-4-5-16(13-22)19(24)15-6-7-18(25-2)17(20)9-15/h6-7,9-10,12,16H,3-5,8,11,13H2,1-2H3 |
| InChIKey | JAENILRVNHPTDP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |