C21H28N4O — CID 45169944
(E)-N-methyl-3-(1-methylpyrazol-4-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]prop-2-enamide (PubChem CID 45169944) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is (E)-N-methyl-3-(1-methylpyrazol-4-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-(1-methylpyrazol-4-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 45169944 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (E)-N-methyl-3-(1-methylpyrazol-4-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cnn(C)c1)C1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N4O/c1-23-16-19(15-22-23)10-11-21(26)24(2)20-9-6-13-25(17-20)14-12-18-7-4-3-5-8-18/h3-5,7-8,10-11,15-16,20H,6,9,12-14,17H2,1-2H3/b11-10+ |
| InChIKey | WZGADGYMYPJTNS-ZHACJKMWSA-N |
| XLogP | 2.60 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|