C21H23F2N5OS — CID 45170151
2,5-difluoro-N-[1-[7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]benzamide (PubChem CID 45170151) has the molecular formula C21H23F2N5OS and a molecular weight of 431.51 g/mol. Its IUPAC name is 2,5-difluoro-N-[1-[7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]benzamide.
| Compound Name | 2,5-difluoro-N-[1-[7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 45170151 |
| Molecular Formula | C21H23F2N5OS |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2,5-difluoro-N-[1-[7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]benzamide |
| SMILES | Cc1ccsc1CN1CCc2nnc(C(C)NC(=O)c3cc(F)ccc3F)n2CC1 |
| InChI | InChI=1S/C21H23F2N5OS/c1-13-6-10-30-18(13)12-27-7-5-19-25-26-20(28(19)9-8-27)14(2)24-21(29)16-11-15(22)3-4-17(16)23/h3-4,6,10-11,14H,5,7-9,12H2,1-2H3,(H,24,29) |
| InChIKey | AQTBCYOBSYJUNM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |