C25H30N2O4S — CID 45170624
2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)-N-propylacetamide (PubChem CID 45170624) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)-N-propylacetamide.
| Compound Name | 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)-N-propylacetamide |
|---|---|
| PubChem CID | 45170624 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)-N-propylacetamide |
| SMILES | CCCN(CC1CCCO1)C(=O)CC1(c2ccccc2)CC(=O)N(Cc2cccs2)C1=O |
| InChI | InChI=1S/C25H30N2O4S/c1-2-12-26(17-20-10-6-13-31-20)22(28)15-25(19-8-4-3-5-9-19)16-23(29)27(24(25)30)18-21-11-7-14-32-21/h3-5,7-9,11,14,20H,2,6,10,12-13,15-18H2,1H3 |
| InChIKey | HRYYHQLUBDSLIS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|