About 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol
2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 45171016) has the molecular formula C18H22F2N2OS
and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol |
| PubChem CID | 45171016 |
| Molecular Formula | C18H22F2N2OS |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(Cc2cc(F)cc(F)c2)CCN1Cc1cccs1 |
| InChI | InChI=1S/C18H22F2N2OS/c19-15-8-14(9-16(20)10-15)11-21-4-5-22(17(12-21)3-6-23)13-18-2-1-7-24-18/h1-2,7-10,17,23H,3-6,11-13H2 |
| InChIKey | YSZTZHMVMISJTJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol?
The IUPAC name of 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol (CID 45171016) is 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol.
What is the SMILES notation for 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol?
The canonical SMILES for 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol is OCCC1CN(Cc2cc(F)cc(F)c2)CCN1Cc1cccs1.
What is the InChIKey of 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol?
The InChIKey is YSZTZHMVMISJTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2OS/c19-15-8-14(9-16(20)10-15)11-21-4-5-22(17(12-21)3-6-23)13-18-2-1-7-24-18/h1-2,7-10,17,23H,3-6,11-13H2.
What are the key properties of 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol?
2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol has a molecular weight of 352.45 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-difluorophenyl)methyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol is sourced from PubChem (CID 45171016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).