C23H39N5O — CID 45171915
2-methyl-N-[1-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide (PubChem CID 45171915) has the molecular formula C23H39N5O and a molecular weight of 401.60 g/mol. Its IUPAC name is 2-methyl-N-[1-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[1-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 45171915 |
| Molecular Formula | C23H39N5O |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | 2-methyl-N-[1-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide |
| SMILES | CC1=C(CCN2CCc3nnc(C(C)NC(=O)C(C)C)n3CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H39N5O/c1-16(2)22(29)24-18(4)21-26-25-20-10-13-27(14-15-28(20)21)12-9-19-17(3)8-7-11-23(19,5)6/h16,18H,7-15H2,1-6H3,(H,24,29) |
| InChIKey | JHNXZDPRHOVKEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|