C20H34N6O — CID 45172462
1-methyl-N-[1-[7-[(E)-2-methylbut-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]piperidine-4-carboxamide (PubChem CID 45172462) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-methyl-N-[1-[7-[(E)-2-methylbut-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[1-[7-[(E)-2-methylbut-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45172462 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-methyl-N-[1-[7-[(E)-2-methylbut-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]piperidine-4-carboxamide |
| SMILES | C/C=C(\C)CN1CCc2nnc(C(C)NC(=O)C3CCN(C)CC3)n2CC1 |
| InChI | InChI=1S/C20H34N6O/c1-5-15(2)14-25-11-8-18-22-23-19(26(18)13-12-25)16(3)21-20(27)17-6-9-24(4)10-7-17/h5,16-17H,6-14H2,1-4H3,(H,21,27)/b15-5+ |
| InChIKey | RWYCRDZOWREPOP-PJQLUOCWSA-N |
| XLogP | 1.62 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|