C22H28FN3O — CID 45173372
2-ethyl-1-[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]butan-1-one (PubChem CID 45173372) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-ethyl-1-[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 2-ethyl-1-[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 45173372 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-ethyl-1-[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]butan-1-one |
| SMILES | CCC(CC)C(=O)N1CCCC(c2nc(C)ncc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H28FN3O/c1-4-16(5-2)22(27)26-12-6-7-18(14-26)21-20(13-24-15(3)25-21)17-8-10-19(23)11-9-17/h8-11,13,16,18H,4-7,12,14H2,1-3H3 |
| InChIKey | OQVWPJSUGMEBCG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |