C24H35N3O3 — CID 45174365
1-(cyclohexylmethyl)-N-[(4-morpholin-4-ylphenyl)methyl]-6-oxopiperidine-3-carboxamide (PubChem CID 45174365) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-[(4-morpholin-4-ylphenyl)methyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-N-[(4-morpholin-4-ylphenyl)methyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45174365 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-[(4-morpholin-4-ylphenyl)methyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCOCC2)cc1)C1CCC(=O)N(CC2CCCCC2)C1 |
| InChI | InChI=1S/C24H35N3O3/c28-23-11-8-21(18-27(23)17-20-4-2-1-3-5-20)24(29)25-16-19-6-9-22(10-7-19)26-12-14-30-15-13-26/h6-7,9-10,20-21H,1-5,8,11-18H2,(H,25,29) |
| InChIKey | KKYSKKCFUPNREB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|