C23H33N3O5 — CID 45174697
2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)acetamide (PubChem CID 45174697) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)acetamide.
| Compound Name | 2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)acetamide |
|---|---|
| PubChem CID | 45174697 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)acetamide |
| SMILES | C=CCC(O)(CC=C)CNC(=O)CC1C(=O)NCCN1Cc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H33N3O5/c1-5-7-23(29,8-6-2)16-25-21(27)14-20-22(28)24-9-10-26(20)15-17-11-18(30-3)13-19(12-17)31-4/h5-6,11-13,20,29H,1-2,7-10,14-16H2,3-4H3,(H,24,28)(H,25,27) |
| InChIKey | PHPOMPMTKSUIAK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|