C18H21F3N2O3 — CID 45174730
1-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]ethyl]pyrrolidin-2-one (PubChem CID 45174730) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 45174730 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC(=O)N1CCOC(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H21F3N2O3/c19-18(20,21)14-4-1-3-13(9-14)10-15-11-23(7-8-26-15)17(25)12-22-6-2-5-16(22)24/h1,3-4,9,15H,2,5-8,10-12H2 |
| InChIKey | ASKFPHFHPYWTPY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |