C19H24FN5O2 — CID 45174874
5-[4-[2-(dimethylamino)-2-(2-fluorophenyl)acetyl]piperazin-1-yl]-2-methylpyridazin-3-one (PubChem CID 45174874) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-[4-[2-(dimethylamino)-2-(2-fluorophenyl)acetyl]piperazin-1-yl]-2-methylpyridazin-3-one.
| Compound Name | 5-[4-[2-(dimethylamino)-2-(2-fluorophenyl)acetyl]piperazin-1-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 45174874 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 5-[4-[2-(dimethylamino)-2-(2-fluorophenyl)acetyl]piperazin-1-yl]-2-methylpyridazin-3-one |
| SMILES | CN(C)C(C(=O)N1CCN(c2cnn(C)c(=O)c2)CC1)c1ccccc1F |
| InChI | InChI=1S/C19H24FN5O2/c1-22(2)18(15-6-4-5-7-16(15)20)19(27)25-10-8-24(9-11-25)14-12-17(26)23(3)21-13-14/h4-7,12-13,18H,8-11H2,1-3H3 |
| InChIKey | IIVYJLXKSHCBSC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |