About N,N'-dibutylbutanediamide
N,N'-dibutylbutanediamide (PubChem CID 4517495) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N'-dibutylbutanediamide.
Molecular Properties
| Compound Name | N,N'-dibutylbutanediamide |
| PubChem CID | 4517495 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N'-dibutylbutanediamide |
| SMILES | CCCCNC(=O)CCC(=O)NCCCC |
| InChI | InChI=1S/C12H24N2O2/c1-3-5-9-13-11(15)7-8-12(16)14-10-6-4-2/h3-10H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | ZWLBGKRKOMBCCC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibutylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibutylbutanediamide?
The IUPAC name of N,N'-dibutylbutanediamide (CID 4517495) is N,N'-dibutylbutanediamide.
What is the SMILES notation for N,N'-dibutylbutanediamide?
The canonical SMILES for N,N'-dibutylbutanediamide is CCCCNC(=O)CCC(=O)NCCCC.
What is the InChIKey of N,N'-dibutylbutanediamide?
The InChIKey is ZWLBGKRKOMBCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-3-5-9-13-11(15)7-8-12(16)14-10-6-4-2/h3-10H2,1-2H3,(H,13,15)(H,14,16).
What are the key properties of N,N'-dibutylbutanediamide?
N,N'-dibutylbutanediamide has a molecular weight of 228.34 g/mol, XLogP of 1.60, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibutylbutanediamide is sourced from PubChem (CID 4517495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).