C20H21N3O4 — CID 45175695
(2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone (PubChem CID 45175695) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone.
| Compound Name | (2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone |
|---|---|
| PubChem CID | 45175695 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone |
| SMILES | CCCCC1CN(C(=O)c2ccc3c(c2)no[n+]3[O-])Cc2ccccc2O1 |
| InChI | InChI=1S/C20H21N3O4/c1-2-3-7-16-13-22(12-15-6-4-5-8-19(15)26-16)20(24)14-9-10-18-17(11-14)21-27-23(18)25/h4-6,8-11,16H,2-3,7,12-13H2,1H3 |
| InChIKey | PNJRQWIJBNBSIN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|