About [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone
[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone (PubChem CID 45175800) has the molecular formula C18H23F2NO
and a molecular weight of 307.38 g/mol. Its IUPAC name is [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone.
Molecular Properties
| Compound Name | [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone |
| PubChem CID | 45175800 |
| Molecular Formula | C18H23F2NO |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone |
| SMILES | CC1(C(=O)N2CCCC(CCc3ccc(F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C18H23F2NO/c1-18(8-9-18)17(22)21-10-2-3-14(12-21)5-4-13-6-7-15(19)16(20)11-13/h6-7,11,14H,2-5,8-10,12H2,1H3 |
| InChIKey | LKRJAERJKRMRGN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone?
The IUPAC name of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone (CID 45175800) is [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone.
What is the SMILES notation for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone?
The canonical SMILES for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone is CC1(C(=O)N2CCCC(CCc3ccc(F)c(F)c3)C2)CC1.
What is the InChIKey of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone?
The InChIKey is LKRJAERJKRMRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2NO/c1-18(8-9-18)17(22)21-10-2-3-14(12-21)5-4-13-6-7-15(19)16(20)11-13/h6-7,11,14H,2-5,8-10,12H2,1H3.
What are the key properties of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone?
[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone has a molecular weight of 307.38 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone is sourced from PubChem (CID 45175800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).