C23H33FN2O2 — CID 45176483
(E)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methyl-N-(oxolan-2-ylmethyl)but-2-enamide (PubChem CID 45176483) has the molecular formula C23H33FN2O2 and a molecular weight of 388.53 g/mol. Its IUPAC name is (E)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methyl-N-(oxolan-2-ylmethyl)but-2-enamide.
| Compound Name | (E)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methyl-N-(oxolan-2-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 45176483 |
| Molecular Formula | C23H33FN2O2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (E)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methyl-N-(oxolan-2-ylmethyl)but-2-enamide |
| SMILES | C/C=C(\C)C(=O)N(CC1CCN(Cc2ccccc2F)CC1)CC1CCCO1 |
| InChI | InChI=1S/C23H33FN2O2/c1-3-18(2)23(27)26(17-21-8-6-14-28-21)15-19-10-12-25(13-11-19)16-20-7-4-5-9-22(20)24/h3-5,7,9,19,21H,6,8,10-17H2,1-2H3/b18-3+ |
| InChIKey | FQXDSFGTZHWFHP-JFQJCAQQSA-N |
| XLogP | 4.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|