About azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone
azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone (PubChem CID 45176633) has the molecular formula C17H26N4OS2
and a molecular weight of 366.56 g/mol. Its IUPAC name is azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone.
Molecular Properties
| Compound Name | azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
| PubChem CID | 45176633 |
| Molecular Formula | C17H26N4OS2 |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
| SMILES | CSCCNCc1c(C(=O)N2CCCCCCC2)nc2sccn12 |
| InChI | InChI=1S/C17H26N4OS2/c1-23-11-7-18-13-14-15(19-17-21(14)10-12-24-17)16(22)20-8-5-3-2-4-6-9-20/h10,12,18H,2-9,11,13H2,1H3 |
| InChIKey | RPZIREVSLPOKKA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone?
The IUPAC name of azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone (CID 45176633) is azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone.
What is the SMILES notation for azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone?
The canonical SMILES for azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone is CSCCNCc1c(C(=O)N2CCCCCCC2)nc2sccn12.
What is the InChIKey of azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone?
The InChIKey is RPZIREVSLPOKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4OS2/c1-23-11-7-18-13-14-15(19-17-21(14)10-12-24-17)16(22)20-8-5-3-2-4-6-9-20/h10,12,18H,2-9,11,13H2,1H3.
What are the key properties of azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone?
azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone has a molecular weight of 366.56 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azocan-1-yl-[5-[(2-methylsulfanylethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone is sourced from PubChem (CID 45176633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).