C21H25N5O2S2 — CID 45177143
4-[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole (PubChem CID 45177143) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 4-[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 45177143 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CCCC(N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H25N5O2S2/c27-30(28,20-10-4-9-19-21(20)23-29-22-19)26-11-5-8-18(16-26)25-14-12-24(13-15-25)17-6-2-1-3-7-17/h1-4,6-7,9-10,18H,5,8,11-16H2 |
| InChIKey | UIPVAGGYYVHTMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |