About N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide
N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide (PubChem CID 45177344) has the molecular formula C24H27N3OS
and a molecular weight of 405.57 g/mol. Its IUPAC name is N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide |
| PubChem CID | 45177344 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide |
| SMILES | Cc1ncc(CN2CCCC(CNC(=O)c3ccc(-c4ccccc4)cc3)C2)s1 |
| InChI | InChI=1S/C24H27N3OS/c1-18-25-15-23(29-18)17-27-13-5-6-19(16-27)14-26-24(28)22-11-9-21(10-12-22)20-7-3-2-4-8-20/h2-4,7-12,15,19H,5-6,13-14,16-17H2,1H3,(H,26,28) |
| InChIKey | ROQMNDNMLOMTPF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide?
The IUPAC name of N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide (CID 45177344) is N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide.
What is the SMILES notation for N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide?
The canonical SMILES for N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide is Cc1ncc(CN2CCCC(CNC(=O)c3ccc(-c4ccccc4)cc3)C2)s1.
What is the InChIKey of N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide?
The InChIKey is ROQMNDNMLOMTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3OS/c1-18-25-15-23(29-18)17-27-13-5-6-19(16-27)14-26-24(28)22-11-9-21(10-12-22)20-7-3-2-4-8-20/h2-4,7-12,15,19H,5-6,13-14,16-17H2,1H3,(H,26,28).
What are the key properties of N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide?
N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide has a molecular weight of 405.57 g/mol, XLogP of 4.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-4-phenylbenzamide is sourced from PubChem (CID 45177344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).