About [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol
[5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol (PubChem CID 45177492) has the molecular formula C19H23F2NO2
and a molecular weight of 335.39 g/mol. Its IUPAC name is [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol |
| PubChem CID | 45177492 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CN2CCCC(CCc3ccc(F)c(F)c3)C2)o1 |
| InChI | InChI=1S/C19H23F2NO2/c20-18-8-5-14(10-19(18)21)3-4-15-2-1-9-22(11-15)12-16-6-7-17(13-23)24-16/h5-8,10,15,23H,1-4,9,11-13H2 |
| InChIKey | LXCMFSSPPVNOKP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol?
The IUPAC name of [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol (CID 45177492) is [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol?
The canonical SMILES for [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol is OCc1ccc(CN2CCCC(CCc3ccc(F)c(F)c3)C2)o1.
What is the InChIKey of [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol?
The InChIKey is LXCMFSSPPVNOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F2NO2/c20-18-8-5-14(10-19(18)21)3-4-15-2-1-9-22(11-15)12-16-6-7-17(13-23)24-16/h5-8,10,15,23H,1-4,9,11-13H2.
What are the key properties of [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol?
[5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol has a molecular weight of 335.39 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]methyl]furan-2-yl]methanol is sourced from PubChem (CID 45177492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).