C19H19ClN4OS — CID 45177780
N-[(5-chlorothiophen-2-yl)methyl]-1-(4-methylquinazolin-2-yl)pyrrolidine-2-carboxamide (PubChem CID 45177780) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-(4-methylquinazolin-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-(4-methylquinazolin-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45177780 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-(4-methylquinazolin-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1nc(N2CCCC2C(=O)NCc2ccc(Cl)s2)nc2ccccc12 |
| InChI | InChI=1S/C19H19ClN4OS/c1-12-14-5-2-3-6-15(14)23-19(22-12)24-10-4-7-16(24)18(25)21-11-13-8-9-17(20)26-13/h2-3,5-6,8-9,16H,4,7,10-11H2,1H3,(H,21,25) |
| InChIKey | TZWXBZLZVRNVCW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |