C20H24ClFN4O — CID 45178291
[1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]-(3-cyclohexylpyrrolidin-1-yl)methanone (PubChem CID 45178291) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is [1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]-(3-cyclohexylpyrrolidin-1-yl)methanone.
| Compound Name | [1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]-(3-cyclohexylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 45178291 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]-(3-cyclohexylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cn(Cc2ccc(F)cc2Cl)nn1)N1CCC(C2CCCCC2)C1 |
| InChI | InChI=1S/C20H24ClFN4O/c21-18-10-17(22)7-6-16(18)12-26-13-19(23-24-26)20(27)25-9-8-15(11-25)14-4-2-1-3-5-14/h6-7,10,13-15H,1-5,8-9,11-12H2 |
| InChIKey | HJLHKCHARFVSHU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |