About [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone
[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 45179184) has the molecular formula C19H20F2N2O
and a molecular weight of 330.38 g/mol. Its IUPAC name is [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| PubChem CID | 45179184 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC(CCc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C19H20F2N2O/c20-17-6-1-7-18(21)16(17)9-8-14-4-3-11-23(13-14)19(24)15-5-2-10-22-12-15/h1-2,5-7,10,12,14H,3-4,8-9,11,13H2 |
| InChIKey | CWXJNIVAHYORFQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The IUPAC name of [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone (CID 45179184) is [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone.
What is the SMILES notation for [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The canonical SMILES for [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone is O=C(c1cccnc1)N1CCCC(CCc2c(F)cccc2F)C1.
What is the InChIKey of [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The InChIKey is CWXJNIVAHYORFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2N2O/c20-17-6-1-7-18(21)16(17)9-8-14-4-3-11-23(13-14)19(24)15-5-2-10-22-12-15/h1-2,5-7,10,12,14H,3-4,8-9,11,13H2.
What are the key properties of [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone?
[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone has a molecular weight of 330.38 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-pyridin-3-ylmethanone is sourced from PubChem (CID 45179184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).