C20H28N2O2 — CID 45179241
2-butanoyl-7-[(3-methylphenyl)methyl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 45179241) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-butanoyl-7-[(3-methylphenyl)methyl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 2-butanoyl-7-[(3-methylphenyl)methyl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 45179241 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-butanoyl-7-[(3-methylphenyl)methyl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | CCCC(=O)N1CCC2(CCCN(Cc3cccc(C)c3)C2=O)C1 |
| InChI | InChI=1S/C20H28N2O2/c1-3-6-18(23)22-12-10-20(15-22)9-5-11-21(19(20)24)14-17-8-4-7-16(2)13-17/h4,7-8,13H,3,5-6,9-12,14-15H2,1-2H3 |
| InChIKey | SBFPIPFZIAYQRS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |