C20H37N3O2 — CID 45179446
1-(2-cyclohexylethyl)-3-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxypiperidin-2-one (PubChem CID 45179446) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-3-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxypiperidin-2-one.
| Compound Name | 1-(2-cyclohexylethyl)-3-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 45179446 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 1-(2-cyclohexylethyl)-3-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxypiperidin-2-one |
| SMILES | CCN1CCN(CC2(O)CCCN(CCC3CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C20H37N3O2/c1-2-21-13-15-22(16-14-21)17-20(25)10-6-11-23(19(20)24)12-9-18-7-4-3-5-8-18/h18,25H,2-17H2,1H3 |
| InChIKey | HJEBGIPVMLRWGC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |