C18H29N5O — CID 45180707
1-[1-[2-(azocan-1-yl)-4-methylpyrimidin-5-yl]ethyl]-3-prop-2-enylurea (PubChem CID 45180707) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[1-[2-(azocan-1-yl)-4-methylpyrimidin-5-yl]ethyl]-3-prop-2-enylurea.
| Compound Name | 1-[1-[2-(azocan-1-yl)-4-methylpyrimidin-5-yl]ethyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 45180707 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 1-[1-[2-(azocan-1-yl)-4-methylpyrimidin-5-yl]ethyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC(C)c1cnc(N2CCCCCCC2)nc1C |
| InChI | InChI=1S/C18H29N5O/c1-4-10-19-18(24)22-15(3)16-13-20-17(21-14(16)2)23-11-8-6-5-7-9-12-23/h4,13,15H,1,5-12H2,2-3H3,(H2,19,22,24) |
| InChIKey | MCQJMNHGVHHCCJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|