C24H29N3O3 — CID 45180985
4-[[[1-(2,3-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-2,6-dimethoxyphenol (PubChem CID 45180985) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[[[1-(2,3-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[[1-(2,3-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 45180985 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[[[1-(2,3-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNC2CCCc3c2cnn3-c2cccc(C)c2C)cc(OC)c1O |
| InChI | InChI=1S/C24H29N3O3/c1-15-7-5-9-20(16(15)2)27-21-10-6-8-19(18(21)14-26-27)25-13-17-11-22(29-3)24(28)23(12-17)30-4/h5,7,9,11-12,14,19,25,28H,6,8,10,13H2,1-4H3 |
| InChIKey | RSHDPBNKDWQADJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |