About 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one
4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one (PubChem CID 45182021) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one |
| PubChem CID | 45182021 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one |
| SMILES | Cc1cc(C)nc(NC2CC(=O)N(C)C2)n1 |
| InChI | InChI=1S/C11H16N4O/c1-7-4-8(2)13-11(12-7)14-9-5-10(16)15(3)6-9/h4,9H,5-6H2,1-3H3,(H,12,13,14) |
| InChIKey | BQJWRVKLLATJJF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one?
The IUPAC name of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one (CID 45182021) is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one.
What is the SMILES notation for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one?
The canonical SMILES for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one is Cc1cc(C)nc(NC2CC(=O)N(C)C2)n1.
What is the InChIKey of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one?
The InChIKey is BQJWRVKLLATJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-7-4-8(2)13-11(12-7)14-9-5-10(16)15(3)6-9/h4,9H,5-6H2,1-3H3,(H,12,13,14).
What are the key properties of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one?
4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one has a molecular weight of 220.28 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpyrrolidin-2-one is sourced from PubChem (CID 45182021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).