About 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one
1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 45182420) has the molecular formula C23H23F2N3O
and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one |
| PubChem CID | 45182420 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCCC(c2[nH]ncc2-c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C23H23F2N3O/c24-20-10-9-17(13-21(20)25)19-14-26-27-23(19)18-7-4-12-28(15-18)22(29)11-8-16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,18H,4,7-8,11-12,15H2,(H,26,27) |
| InChIKey | XOAMRYLOAQIWPJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one?
The IUPAC name of 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one (CID 45182420) is 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one.
What is the SMILES notation for 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one?
The canonical SMILES for 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one is O=C(CCc1ccccc1)N1CCCC(c2[nH]ncc2-c2ccc(F)c(F)c2)C1.
What is the InChIKey of 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one?
The InChIKey is XOAMRYLOAQIWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F2N3O/c24-20-10-9-17(13-21(20)25)19-14-26-27-23(19)18-7-4-12-28(15-18)22(29)11-8-16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,18H,4,7-8,11-12,15H2,(H,26,27).
What are the key properties of 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one?
1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one has a molecular weight of 395.45 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-3-phenylpropan-1-one is sourced from PubChem (CID 45182420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).