C16H19N2+ — CID 4518244
3-benzyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-4-ium (PubChem CID 4518244) has the molecular formula C16H19N2+ and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-benzyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-4-ium.
| Compound Name | 3-benzyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-4-ium |
|---|---|
| PubChem CID | 4518244 |
| Molecular Formula | C16H19N2+ |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-benzyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-4-ium |
| SMILES | c1ccc(CC2CNc3ccccc3C[NH2+]2)cc1 |
| InChI | InChI=1S/C16H18N2/c1-2-6-13(7-3-1)10-15-12-18-16-9-5-4-8-14(16)11-17-15/h1-9,15,17-18H,10-12H2/p+1 |
| InChIKey | CJNOSBLATHYVBH-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 28.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |