C28H30N2O6 — CID 45182493
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-oxo-2-(3-propanoylpiperidin-1-yl)ethyl]-3-phenylpyrrolidine-2,5-dione (PubChem CID 45182493) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-oxo-2-(3-propanoylpiperidin-1-yl)ethyl]-3-phenylpyrrolidine-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-oxo-2-(3-propanoylpiperidin-1-yl)ethyl]-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45182493 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-oxo-2-(3-propanoylpiperidin-1-yl)ethyl]-3-phenylpyrrolidine-2,5-dione |
| SMILES | CCC(=O)C1CCCN(C(=O)CC2(c3ccccc3)CC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)C1 |
| InChI | InChI=1S/C28H30N2O6/c1-2-22(31)20-7-6-12-29(17-20)25(32)14-28(21-8-4-3-5-9-21)15-26(33)30(27(28)34)16-19-10-11-23-24(13-19)36-18-35-23/h3-5,8-11,13,20H,2,6-7,12,14-18H2,1H3 |
| InChIKey | JOENZNRUZLDGNT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|