C16H25NO4 — CID 45182494
(5-methoxyfuran-2-yl)-[2-(4-methylpentyl)morpholin-4-yl]methanone (PubChem CID 45182494) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (5-methoxyfuran-2-yl)-[2-(4-methylpentyl)morpholin-4-yl]methanone.
| Compound Name | (5-methoxyfuran-2-yl)-[2-(4-methylpentyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 45182494 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (5-methoxyfuran-2-yl)-[2-(4-methylpentyl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCOC(CCCC(C)C)C2)o1 |
| InChI | InChI=1S/C16H25NO4/c1-12(2)5-4-6-13-11-17(9-10-20-13)16(18)14-7-8-15(19-3)21-14/h7-8,12-13H,4-6,9-11H2,1-3H3 |
| InChIKey | PZDQPLHAUJJPKY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |