C27H37N3O4 — CID 45183357
N-[4-[4-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 45183357) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[4-[4-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 45183357 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | N-[4-[4-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | COc1cccc(OCC(O)CNC2CCN(c3ccc(NC(=O)C4CCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H37N3O4/c1-33-25-7-4-8-26(17-25)34-19-24(31)18-28-21-13-15-30(16-14-21)23-11-9-22(10-12-23)29-27(32)20-5-2-3-6-20/h4,7-12,17,20-21,24,28,31H,2-3,5-6,13-16,18-19H2,1H3,(H,29,32) |
| InChIKey | CCRDXHQCLHIVTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|