C20H27N5O2 — CID 45183420
N-[(5-oxopyrrolidin-2-yl)methyl]-1-(3-phenylpropyl)-N-propan-2-yltriazole-4-carboxamide (PubChem CID 45183420) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(5-oxopyrrolidin-2-yl)methyl]-1-(3-phenylpropyl)-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | N-[(5-oxopyrrolidin-2-yl)methyl]-1-(3-phenylpropyl)-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 45183420 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[(5-oxopyrrolidin-2-yl)methyl]-1-(3-phenylpropyl)-N-propan-2-yltriazole-4-carboxamide |
| SMILES | CC(C)N(CC1CCC(=O)N1)C(=O)c1cn(CCCc2ccccc2)nn1 |
| InChI | InChI=1S/C20H27N5O2/c1-15(2)25(13-17-10-11-19(26)21-17)20(27)18-14-24(23-22-18)12-6-9-16-7-4-3-5-8-16/h3-5,7-8,14-15,17H,6,9-13H2,1-2H3,(H,21,26) |
| InChIKey | SUPXCARSTDJMKX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |