C23H23ClFN3O — CID 45184058
4-chloro-2-[[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol (PubChem CID 45184058) has the molecular formula C23H23ClFN3O and a molecular weight of 411.91 g/mol. Its IUPAC name is 4-chloro-2-[[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 4-chloro-2-[[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45184058 |
| Molecular Formula | C23H23ClFN3O |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-chloro-2-[[3-[5-(4-fluorophenyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
| SMILES | Cc1ncc(-c2ccc(F)cc2)c(C2CCCN(Cc3cc(Cl)ccc3O)C2)n1 |
| InChI | InChI=1S/C23H23ClFN3O/c1-15-26-12-21(16-4-7-20(25)8-5-16)23(27-15)17-3-2-10-28(13-17)14-18-11-19(24)6-9-22(18)29/h4-9,11-12,17,29H,2-3,10,13-14H2,1H3 |
| InChIKey | QFWNGGNAPXIZLM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|