About [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol
[1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol (PubChem CID 45184442) has the molecular formula C17H29ClN4O
and a molecular weight of 340.90 g/mol. Its IUPAC name is [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol |
| PubChem CID | 45184442 |
| Molecular Formula | C17H29ClN4O |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCCC(N2CCC(CO)CC2)C1 |
| InChI | InChI=1S/C17H29ClN4O/c1-13-16(17(18)20(2)19-13)11-21-7-3-4-15(10-21)22-8-5-14(12-23)6-9-22/h14-15,23H,3-12H2,1-2H3 |
| InChIKey | KCKALNXLAMHWKE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol?
The IUPAC name of [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol (CID 45184442) is [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol is Cc1nn(C)c(Cl)c1CN1CCCC(N2CCC(CO)CC2)C1.
What is the InChIKey of [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol?
The InChIKey is KCKALNXLAMHWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29ClN4O/c1-13-16(17(18)20(2)19-13)11-21-7-3-4-15(10-21)22-8-5-14(12-23)6-9-22/h14-15,23H,3-12H2,1-2H3.
What are the key properties of [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol?
[1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol has a molecular weight of 340.90 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperidin-4-yl]methanol is sourced from PubChem (CID 45184442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).