C23H22F2N4O — CID 45185399
2-(7-fluoro-2-methyl-1H-indol-3-yl)-N-[1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]acetamide (PubChem CID 45185399) has the molecular formula C23H22F2N4O and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-(7-fluoro-2-methyl-1H-indol-3-yl)-N-[1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]acetamide.
| Compound Name | 2-(7-fluoro-2-methyl-1H-indol-3-yl)-N-[1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 45185399 |
| Molecular Formula | C23H22F2N4O |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-(7-fluoro-2-methyl-1H-indol-3-yl)-N-[1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]acetamide |
| SMILES | Cc1[nH]c2c(F)cccc2c1CC(=O)NC(C)c1cnn(-c2cccc(F)c2)c1C |
| InChI | InChI=1S/C23H22F2N4O/c1-13-19(18-8-5-9-21(25)23(18)28-13)11-22(30)27-14(2)20-12-26-29(15(20)3)17-7-4-6-16(24)10-17/h4-10,12,14,28H,11H2,1-3H3,(H,27,30) |
| InChIKey | OGFHPIKKZYELFC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|