C13H10Cl2N2O2S2 — CID 4518557
1-(2,3-dichlorophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 4518557) has the molecular formula C13H10Cl2N2O2S2 and a molecular weight of 361.28 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4518557 |
| Molecular Formula | C13H10Cl2N2O2S2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(SC2=NCCS2)C(=O)N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2N2O2S2/c14-7-2-1-3-8(11(7)15)17-10(18)6-9(12(17)19)21-13-16-4-5-20-13/h1-3,9H,4-6H2 |
| InChIKey | DGHNLQXMPDTSKS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|