C29H37FN2O3 — CID 45186800
N-[1-[1-[(E)-3-(4-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-(3-methoxyphenyl)ethyl]-N,3-dimethylbutanamide (PubChem CID 45186800) has the molecular formula C29H37FN2O3 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-[1-[1-[(E)-3-(4-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-(3-methoxyphenyl)ethyl]-N,3-dimethylbutanamide.
| Compound Name | N-[1-[1-[(E)-3-(4-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-(3-methoxyphenyl)ethyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 45186800 |
| Molecular Formula | C29H37FN2O3 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-[1-[1-[(E)-3-(4-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-(3-methoxyphenyl)ethyl]-N,3-dimethylbutanamide |
| SMILES | COc1cccc(CC(C2CCN(C(=O)/C=C/c3ccc(F)cc3)CC2)N(C)C(=O)CC(C)C)c1 |
| InChI | InChI=1S/C29H37FN2O3/c1-21(2)18-29(34)31(3)27(20-23-6-5-7-26(19-23)35-4)24-14-16-32(17-15-24)28(33)13-10-22-8-11-25(30)12-9-22/h5-13,19,21,24,27H,14-18,20H2,1-4H3/b13-10+ |
| InChIKey | XFORYGAMUWKZGD-JLHYYAGUSA-N |
| XLogP | 5.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|