C20H21F2NOS — CID 45187126
5-(cyclopropylmethyl)-2-(3,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 45187126) has the molecular formula C20H21F2NOS and a molecular weight of 361.46 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-2-(3,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 5-(cyclopropylmethyl)-2-(3,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 45187126 |
| Molecular Formula | C20H21F2NOS |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5-(cyclopropylmethyl)-2-(3,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | COc1ccc2c(c1)SC(c1ccc(F)c(F)c1)CCN2CC1CC1 |
| InChI | InChI=1S/C20H21F2NOS/c1-24-15-5-7-18-20(11-15)25-19(8-9-23(18)12-13-2-3-13)14-4-6-16(21)17(22)10-14/h4-7,10-11,13,19H,2-3,8-9,12H2,1H3 |
| InChIKey | XRNYQCHIFODJDB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|