C20H27N3O3 — CID 45188207
3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[3-(4-methoxyanilino)piperidin-1-yl]propan-1-one (PubChem CID 45188207) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[3-(4-methoxyanilino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[3-(4-methoxyanilino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 45188207 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[3-(4-methoxyanilino)piperidin-1-yl]propan-1-one |
| SMILES | COc1ccc(NC2CCCN(C(=O)CCc3c(C)noc3C)C2)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-14-19(15(2)26-22-14)10-11-20(24)23-12-4-5-17(13-23)21-16-6-8-18(25-3)9-7-16/h6-9,17,21H,4-5,10-13H2,1-3H3 |
| InChIKey | MRGYRJOUTKDKEJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|