C25H31ClN6O3 — CID 45188606
N-[1-[7-[(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]pyridine-2-carboxamide (PubChem CID 45188606) has the molecular formula C25H31ClN6O3 and a molecular weight of 499.02 g/mol. Its IUPAC name is N-[1-[7-[(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]pyridine-2-carboxamide.
| Compound Name | N-[1-[7-[(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45188606 |
| Molecular Formula | C25H31ClN6O3 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[1-[7-[(2-chloro-4,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]pyridine-2-carboxamide |
| SMILES | COc1cc(Cl)c(CN2CCc3nnc(C(NC(=O)c4ccccn4)C(C)C)n3CC2)cc1OC |
| InChI | InChI=1S/C25H31ClN6O3/c1-16(2)23(28-25(33)19-7-5-6-9-27-19)24-30-29-22-8-10-31(11-12-32(22)24)15-17-13-20(34-3)21(35-4)14-18(17)26/h5-7,9,13-14,16,23H,8,10-12,15H2,1-4H3,(H,28,33) |
| InChIKey | IPYICOAOBLWLNO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |