C26H30N2O4 — CID 45188774
N-[(2,4-dimethoxyphenyl)methyl]-3-[1-(3-ethynylbenzoyl)piperidin-3-yl]propanamide (PubChem CID 45188774) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-[1-(3-ethynylbenzoyl)piperidin-3-yl]propanamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[1-(3-ethynylbenzoyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 45188774 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[1-(3-ethynylbenzoyl)piperidin-3-yl]propanamide |
| SMILES | C#Cc1cccc(C(=O)N2CCCC(CCC(=O)NCc3ccc(OC)cc3OC)C2)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-4-19-7-5-9-21(15-19)26(30)28-14-6-8-20(18-28)10-13-25(29)27-17-22-11-12-23(31-2)16-24(22)32-3/h1,5,7,9,11-12,15-16,20H,6,8,10,13-14,17-18H2,2-3H3,(H,27,29) |
| InChIKey | YWECBUPOHBPUSE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|